C25H34ClN3O5 — CID 23813474
(5R,6S,7S)-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813474) has the molecular formula C25H34ClN3O5 and a molecular weight of 492.02 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813474 |
| Molecular Formula | C25H34ClN3O5 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)Nc3ccccc3Cl)C23CC(C)[C@]1(C)O3 |
| InChI | InChI=1S/C25H34ClN3O5/c1-4-11-27-21(31)18-19-23(33)29(12-7-8-13-30)20(25(19)14-15(2)24(18,3)34-25)22(32)28-17-10-6-5-9-16(17)26/h5-6,9-10,15,18-20,30H,4,7-8,11-14H2,1-3H3,(H,27,31)(H,28,32)/t15?,18-,19+,20?,24+,25?/m1/s1 |
| InChIKey | UYLXNJGAEAHVFW-JKZVGUOUSA-N |
| XLogP | 2.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|