C31H38ClN3O5 — CID 23870289
(5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870289) has the molecular formula C31H38ClN3O5 and a molecular weight of 568.11 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870289 |
| Molecular Formula | C31H38ClN3O5 |
| Molecular Weight | 568.11 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chloro-6-methylphenyl)-3-(6-hydroxyhexyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@@]3(C)OC12CC3C |
| InChI | InChI=1S/C31H38ClN3O5/c1-19-12-11-15-22(32)25(19)34-28(38)26-31-18-20(2)30(3,40-31)23(27(37)33-21-13-7-6-8-14-21)24(31)29(39)35(26)16-9-4-5-10-17-36/h6-8,11-15,20,23-24,26,36H,4-5,9-10,16-18H2,1-3H3,(H,33,37)(H,34,38)/t20?,23-,24+,26?,30+,31?/m1/s1 |
| InChIKey | XXLBTUACHKWYGG-BTGJJSCNSA-N |
| XLogP | 4.79 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|