C29H35N3O5 — CID 23952254
(5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23952254) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23952254 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (5R,6S,7S)-2-N-(2,6-dimethylphenyl)-3-(4-hydroxybutyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@]3(C)CCC12O3 |
| InChI | InChI=1S/C29H35N3O5/c1-18-10-9-11-19(2)23(18)31-26(35)24-29-15-14-28(3,37-29)21(25(34)30-20-12-5-4-6-13-20)22(29)27(36)32(24)16-7-8-17-33/h4-6,9-13,21-22,24,33H,7-8,14-17H2,1-3H3,(H,30,34)(H,31,35)/t21-,22+,24?,28+,29?/m1/s1 |
| InChIKey | ZLMDBEVBQDYALC-HUMMQCNRSA-N |
| XLogP | 3.42 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|