C29H35N3O5 — CID 23898214
(5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898214) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898214 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,5-dimethylphenyl)-3-(2-hydroxyethyl)-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2N(CCO)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@]4(C)OC23CC4C)c1 |
| InChI | InChI=1S/C29H35N3O5/c1-17-10-11-18(2)21(14-17)31-26(35)24-29-15-19(3)28(4,37-29)22(23(29)27(36)32(24)12-13-33)25(34)30-16-20-8-6-5-7-9-20/h5-11,14,19,22-24,33H,12-13,15-16H2,1-4H3,(H,30,34)(H,31,35)/t19?,22-,23+,24?,28+,29?/m1/s1 |
| InChIKey | JYYQVXMIXHPXRA-KMDXWXLNSA-N |
| XLogP | 2.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |