C27H39N3O5 — CID 23870229
(5R,6S,7S)-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870229) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870229 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (5R,6S,7S)-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@H](C)[C@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NC)[C@@]3(C)OC2(CC3C)C1C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C27H39N3O5/c1-8-15(3)19(13-31)30-22(24(33)29-18-11-14(2)9-10-16(18)4)27-12-17(5)26(6,35-27)20(23(32)28-7)21(27)25(30)34/h9-11,15,17,19-22,31H,8,12-13H2,1-7H3,(H,28,32)(H,29,33)/t15-,17?,19-,20+,21-,22?,26-,27?/m0/s1 |
| InChIKey | MGUIQVMUZFKAGS-PGYSDNNKSA-N |
| XLogP | 2.41 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |