C34H45N3O6 — CID 23840480
(5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840480) has the molecular formula C34H45N3O6 and a molecular weight of 591.75 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840480 |
| Molecular Formula | C34H45N3O6 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | (5R,6R,7R)-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc4cc(C)ccc4C)C34CC[C@@]2(CC)O4)cc1 |
| InChI | InChI=1S/C34H45N3O6/c1-7-21(5)26(19-38)37-29(31(40)36-25-18-20(4)10-11-22(25)6)34-17-16-33(8-2,43-34)27(28(34)32(37)41)30(39)35-23-12-14-24(15-13-23)42-9-3/h10-15,18,21,26-29,38H,7-9,16-17,19H2,1-6H3,(H,35,39)(H,36,40)/t21-,26-,27-,28-,29?,33+,34?/m0/s1 |
| InChIKey | RJGAFXIIETXMNO-VCKDFEKBSA-N |
| XLogP | 4.84 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |