C31H39N3O6 — CID 23924225
(5R,6S,7S)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924225) has the molecular formula C31H39N3O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is (5R,6S,7S)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924225 |
| Molecular Formula | C31H39N3O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | (5R,6S,7S)-7-ethyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@H](C)[C@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@]3(CC)CCC2(O3)C1C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H39N3O6/c1-5-19(3)23(18-35)34-26(28(37)33-21-12-14-22(39-4)15-13-21)31-17-16-30(6-2,40-31)24(25(31)29(34)38)27(36)32-20-10-8-7-9-11-20/h7-15,19,23-26,35H,5-6,16-18H2,1-4H3,(H,32,36)(H,33,37)/t19-,23-,24+,25-,26?,30-,31?/m0/s1 |
| InChIKey | KJHLFPWRUCWPLY-UYJZURBNSA-N |
| XLogP | 3.83 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |