C28H41N3O6 — CID 23811408
(5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811408) has the molecular formula C28H41N3O6 and a molecular weight of 515.65 g/mol. Its IUPAC name is (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811408 |
| Molecular Formula | C28H41N3O6 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N(C(CO)CC(C)C)C(C(=O)Nc3ccc(OC)cc3)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C28H41N3O6/c1-6-14-29-24(33)21-22-26(35)31(19(16-32)15-17(3)4)23(28(22)13-12-27(21,7-2)37-28)25(34)30-18-8-10-20(36-5)11-9-18/h8-11,17,19,21-23,32H,6-7,12-16H2,1-5H3,(H,29,33)(H,30,34)/t19?,21-,22+,23?,27+,28?/m1/s1 |
| InChIKey | OEHQERMMCGWISY-QIELOEHXSA-N |
| XLogP | 2.72 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |