C29H43N3O5 — CID 23782409
(5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentan-2-yl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782409) has the molecular formula C29H43N3O5 and a molecular weight of 513.68 g/mol. Its IUPAC name is (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentan-2-yl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentan-2-yl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782409 |
| Molecular Formula | C29H43N3O5 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | (5R,6S,7S)-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-2-N-pentan-2-yl-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCC(C)NC(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@]3(CC)CCC12O3 |
| InChI | InChI=1S/C29H43N3O5/c1-6-11-19(5)30-26(35)24-29-15-14-28(7-2,37-29)22(25(34)31-20-12-9-8-10-13-20)23(29)27(36)32(24)21(17-33)16-18(3)4/h8-10,12-13,18-19,21-24,33H,6-7,11,14-17H2,1-5H3,(H,30,35)(H,31,34)/t19?,21-,22-,23+,24?,28+,29?/m1/s1 |
| InChIKey | NLYDVBUIKLUUHD-CZTYZCNBSA-N |
| XLogP | 3.49 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |