C35H48N4O5 — CID 23753717
(5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753717) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753717 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N([C@@H](CO)CC(C)C)C(=O)[C@@H]3[C@@H](C(=O)NCc4ccccc4)[C@@]4(CC)CCC23O4)cc1 |
| InChI | InChI=1S/C35H48N4O5/c1-6-34-18-19-35(44-34)29(28(34)31(41)36-21-24-12-10-9-11-13-24)33(43)39(27(22-40)20-23(4)5)30(35)32(42)37-25-14-16-26(17-15-25)38(7-2)8-3/h9-17,23,27-30,40H,6-8,18-22H2,1-5H3,(H,36,41)(H,37,42)/t27-,28+,29+,30?,34-,35?/m1/s1 |
| InChIKey | HDKSZKVXUYATNY-FMJDTFTBSA-N |
| XLogP | 4.35 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|