C38H46N4O5 — CID 23981996
(5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981996) has the molecular formula C38H46N4O5 and a molecular weight of 638.81 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981996 |
| Molecular Formula | C38H46N4O5 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N([C@@H](CO)Cc3ccccc3)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@]4(C)OC23CC4C)cc1 |
| InChI | InChI=1S/C38H46N4O5/c1-5-41(6-2)29-19-17-28(18-20-29)40-35(45)33-38-22-25(3)37(4,47-38)31(34(44)39-23-27-15-11-8-12-16-27)32(38)36(46)42(33)30(24-43)21-26-13-9-7-10-14-26/h7-20,25,30-33,43H,5-6,21-24H2,1-4H3,(H,39,44)(H,40,45)/t25?,30-,31-,32+,33?,37+,38?/m1/s1 |
| InChIKey | QYZWTAFTAMHJBW-NFDMXBCTSA-N |
| XLogP | 4.40 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|