C33H42N4O6 — CID 23898261
(5R,6S,7S)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898261) has the molecular formula C33H42N4O6 and a molecular weight of 590.72 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898261 |
| Molecular Formula | C33H42N4O6 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-7,8-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1CC23O[C@]1(C)[C@@H](C(=O)Nc1ccccc1)[C@H]2C(=O)N([C@@H](CO)Cc1ccccc1)C3C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C33H42N4O6/c1-22-20-33-27(26(32(22,2)43-33)29(39)35-24-11-7-4-8-12-24)31(41)37(25(21-38)19-23-9-5-3-6-10-23)28(33)30(40)34-13-14-36-15-17-42-18-16-36/h3-12,22,25-28,38H,13-21H2,1-2H3,(H,34,40)(H,35,39)/t22?,25-,26-,27+,28?,32+,33?/m1/s1 |
| InChIKey | VGFFPVLOSSBJJA-QIBKIEHVSA-N |
| XLogP | 1.69 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |