C31H38N4O6 — CID 23924877
(5R,6R,7R)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924877) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is (5R,6R,7R)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924877 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | (5R,6R,7R)-3-[(1S)-2-hydroxy-1-phenylethyl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@]12CCC3(O1)C(C(=O)NCCN1CCOCC1)N([C@H](CO)c1ccccc1)C(=O)[C@@H]3[C@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C31H38N4O6/c1-30-12-13-31(41-30)25(24(30)27(37)33-22-10-6-3-7-11-22)29(39)35(23(20-36)21-8-4-2-5-9-21)26(31)28(38)32-14-15-34-16-18-40-19-17-34/h2-11,23-26,36H,12-20H2,1H3,(H,32,38)(H,33,37)/t23-,24+,25+,26?,30-,31?/m1/s1 |
| InChIKey | VOVITITZWAOANP-ZUKVNJIWSA-N |
| XLogP | 1.57 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |