C28H40N4O6 — CID 23811679
(5R,6S,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811679) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811679 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@]3(C)CCC2(O3)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C28H40N4O6/c1-3-20(18-33)32-23(25(35)29-11-12-31-13-15-37-16-14-31)28-10-9-27(2,38-28)21(22(28)26(32)36)24(34)30-17-19-7-5-4-6-8-19/h4-8,20-23,33H,3,9-18H2,1-2H3,(H,29,35)(H,30,34)/t20-,21+,22-,23?,27-,28?/m0/s1 |
| InChIKey | VHPOZZDULGBESN-JMMCZOQYSA-N |
| XLogP | 0.29 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |