C27H38N4O5S — CID 23841048
(5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841048) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841048 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-[(2S)-1-hydroxybutan-2-yl]-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CCC2(S3)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C27H38N4O5S/c1-2-19(17-32)31-23(25(34)28-10-11-30-12-14-36-15-13-30)27-9-8-20(37-27)21(22(27)26(31)35)24(33)29-16-18-6-4-3-5-7-18/h3-7,19-23,32H,2,8-17H2,1H3,(H,28,34)(H,29,33)/t19-,20-,21+,22-,23?,27?/m0/s1 |
| InChIKey | WXTVSAYJIWDGTI-BKIHHWOLSA-N |
| XLogP | 0.61 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |