C29H41N3O4S — CID 23869139
(5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869139) has the molecular formula C29H41N3O4S and a molecular weight of 527.73 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869139 |
| Molecular Formula | C29H41N3O4S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)C[C@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CCC2(S3)C1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H41N3O4S/c1-18(2)15-21(17-33)32-25(27(35)31-20-11-7-4-8-12-20)29-14-13-22(37-29)23(24(29)28(32)36)26(34)30-16-19-9-5-3-6-10-19/h3,5-6,9-10,18,20-25,33H,4,7-8,11-17H2,1-2H3,(H,30,34)(H,31,35)/t21-,22+,23-,24+,25?,29?/m1/s1 |
| InChIKey | OTLPIJAJCQUWMY-CAAHIONKSA-N |
| XLogP | 3.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |