C26H28ClN3O4S — CID 23869360
(5S,6S,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869360) has the molecular formula C26H28ClN3O4S and a molecular weight of 514.05 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869360 |
| Molecular Formula | C26H28ClN3O4S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | (5S,6S,7R)-6-N-benzyl-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@H]3CCC2(S3)C1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C26H28ClN3O4S/c1-15(14-31)30-22(24(33)29-18-10-6-5-9-17(18)27)26-12-11-19(35-26)20(21(26)25(30)34)23(32)28-13-16-7-3-2-4-8-16/h2-10,15,19-22,31H,11-14H2,1H3,(H,28,32)(H,29,33)/t15-,19-,20+,21+,22?,26?/m1/s1 |
| InChIKey | KXVQPSBVRCZINJ-CCUQLVICSA-N |
| XLogP | 3.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |