C27H29BrClN3O4S — CID 23981534
(5S,6R,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981534) has the molecular formula C27H29BrClN3O4S and a molecular weight of 606.97 g/mol. Its IUPAC name is (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981534 |
| Molecular Formula | C27H29BrClN3O4S |
| Molecular Weight | 606.97 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCC(CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@H]3SC2(CC3Br)C1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H29BrClN3O4S/c1-2-16(14-33)32-23(25(35)31-19-11-7-6-10-18(19)29)27-12-17(28)22(37-27)20(21(27)26(32)36)24(34)30-13-15-8-4-3-5-9-15/h3-11,16-17,20-23,33H,2,12-14H2,1H3,(H,30,34)(H,31,35)/t16?,17?,20-,21-,22-,23?,27?/m0/s1 |
| InChIKey | YNUMWDGFKMMIRJ-CDFKVHFTSA-N |
| XLogP | 3.83 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|