C27H38BrN3O4S — CID 23812983
(5S,6S,7S)-6-N-benzyl-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812983) has the molecular formula C27H38BrN3O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812983 |
| Molecular Formula | C27H38BrN3O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)CC(CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@H]3SC2(CC3Br)C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C27H38BrN3O4S/c1-15(2)11-17(14-32)31-22(24(34)30-26(3,4)5)27-12-18(28)21(36-27)19(20(27)25(31)35)23(33)29-13-16-9-7-6-8-10-16/h6-10,15,17-22,32H,11-14H2,1-5H3,(H,29,33)(H,30,34)/t17?,18?,19-,20+,21-,22?,27?/m1/s1 |
| InChIKey | UTCVDFOIOCBVQF-BVWLSQTHSA-N |
| XLogP | 3.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|