C22H28BrN3O4S — CID 23813107
(5S,6S,7S)-2-N-benzyl-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813107) has the molecular formula C22H28BrN3O4S and a molecular weight of 510.45 g/mol. Its IUPAC name is (5S,6S,7S)-2-N-benzyl-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-2-N-benzyl-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813107 |
| Molecular Formula | C22H28BrN3O4S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (5S,6S,7S)-2-N-benzyl-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)NC)[C@@H]3SC2(CC3Br)C1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H28BrN3O4S/c1-3-13(11-27)26-18(20(29)25-10-12-7-5-4-6-8-12)22-9-14(23)17(31-22)15(19(28)24-2)16(22)21(26)30/h4-8,13-18,27H,3,9-11H2,1-2H3,(H,24,28)(H,25,29)/t13-,14?,15+,16-,17+,18?,22?/m0/s1 |
| InChIKey | KKOBCMCEZCBRHV-DQCDYIGGSA-N |
| XLogP | 1.28 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|