C32H31BrClN3O4S — CID 23812866
(5S,6R,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812866) has the molecular formula C32H31BrClN3O4S and a molecular weight of 669.04 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812866 |
| Molecular Formula | C32H31BrClN3O4S |
| Molecular Weight | 669.04 g/mol |
| Exact Mass | 667.09 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)C1N([C@@H](CO)Cc2ccccc2)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@H]3SC12CC3Br |
| InChI | InChI=1S/C32H31BrClN3O4S/c1-18-9-8-14-23(34)26(18)36-30(40)28-32-16-22(33)27(42-32)24(29(39)35-20-12-6-3-7-13-20)25(32)31(41)37(28)21(17-38)15-19-10-4-2-5-11-19/h2-14,21-22,24-25,27-28,38H,15-17H2,1H3,(H,35,39)(H,36,40)/t21-,22?,24+,25+,27+,28?,32?/m1/s1 |
| InChIKey | JTNXZHWBQSGEEY-HNDRMFOZSA-N |
| XLogP | 5.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.04 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|