C28H31BrClN3O4S — CID 23953733
(5S,6S,7S)-6-N-benzyl-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953733) has the molecular formula C28H31BrClN3O4S and a molecular weight of 621.00 g/mol. Its IUPAC name is (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953733 |
| Molecular Formula | C28H31BrClN3O4S |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | (5S,6S,7S)-6-N-benzyl-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@H]3SC12CC3Br |
| InChI | InChI=1S/C28H31BrClN3O4S/c1-16-8-7-11-19(30)22(16)32-26(36)24-28-14-18(29)23(38-28)20(21(28)27(37)33(24)12-5-6-13-34)25(35)31-15-17-9-3-2-4-10-17/h2-4,7-11,18,20-21,23-24,34H,5-6,12-15H2,1H3,(H,31,35)(H,32,36)/t18?,20-,21+,23-,24?,28?/m1/s1 |
| InChIKey | DSPABOPRDLWOLT-TWPOQBFYSA-N |
| XLogP | 4.14 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|