C23H30BrN3O4S — CID 23897658
(5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897658) has the molecular formula C23H30BrN3O4S and a molecular weight of 524.48 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897658 |
| Molecular Formula | C23H30BrN3O4S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(2-hydroxyethyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)Nc3c(C)cccc3C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C23H30BrN3O4S/c1-4-8-25-20(29)15-16-22(31)27(9-10-28)19(23(16)11-14(24)18(15)32-23)21(30)26-17-12(2)6-5-7-13(17)3/h5-7,14-16,18-19,28H,4,8-11H2,1-3H3,(H,25,29)(H,26,30)/t14?,15-,16-,18-,19?,23?/m0/s1 |
| InChIKey | BBPRVOOXIGYKGP-IQWWAQGPSA-N |
| XLogP | 2.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|