C24H30BrClN2O5S — CID 23751969
ethyl (5S,6R,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751969) has the molecular formula C24H30BrClN2O5S and a molecular weight of 573.94 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751969 |
| Molecular Formula | C24H30BrClN2O5S |
| Molecular Weight | 573.94 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-2-[(2-chloro-6-methylphenyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)Nc3c(C)cccc3Cl)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C24H30BrClN2O5S/c1-3-33-23(32)16-17-22(31)28(10-5-4-6-11-29)20(24(17)12-14(25)19(16)34-24)21(30)27-18-13(2)8-7-9-15(18)26/h7-9,14,16-17,19-20,29H,3-6,10-12H2,1-2H3,(H,27,30)/t14?,16-,17-,19-,20?,24?/m0/s1 |
| InChIKey | PNYWEAWAPJIQAM-VIGYURINSA-N |
| XLogP | 3.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|