C27H38BrN3O5S — CID 23838704
ethyl (5S,6S,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838704) has the molecular formula C27H38BrN3O5S and a molecular weight of 596.59 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838704 |
| Molecular Formula | C27H38BrN3O5S |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2ccc(N(CC)CC)cc2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H38BrN3O5S/c1-4-30(5-2)18-12-10-17(11-13-18)29-24(33)23-27-16-19(28)22(37-27)20(26(35)36-6-3)21(27)25(34)31(23)14-8-7-9-15-32/h10-13,19-23,32H,4-9,14-16H2,1-3H3,(H,29,33)/t19?,20-,21+,22-,23?,27?/m1/s1 |
| InChIKey | NGQLTRCLKYEGJC-HSUZDRLVSA-N |
| XLogP | 3.66 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|