C24H38BrN3O6S — CID 23781076
ethyl (5S,6R,7R)-8-bromo-3-(6-hydroxyhexyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23781076) has the molecular formula C24H38BrN3O6S and a molecular weight of 576.55 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-3-(6-hydroxyhexyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-3-(6-hydroxyhexyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23781076 |
| Molecular Formula | C24H38BrN3O6S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-3-(6-hydroxyhexyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)NCCN3CCOCC3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C24H38BrN3O6S/c1-2-34-23(32)17-18-22(31)28(8-5-3-4-6-12-29)20(24(18)15-16(25)19(17)35-24)21(30)26-7-9-27-10-13-33-14-11-27/h16-20,29H,2-15H2,1H3,(H,26,30)/t16?,17-,18-,19-,20?,24?/m0/s1 |
| InChIKey | RZLHVWBUVITXAZ-AHVPKAEVSA-N |
| XLogP | 1.02 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|