C21H33BrN4O5S — CID 23897919
(5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897919) has the molecular formula C21H33BrN4O5S and a molecular weight of 533.49 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897919 |
| Molecular Formula | C21H33BrN4O5S |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | (5S,6S,7S)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-6-N-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCC(CO)N1C(=O)[C@@H]2[C@@H](C(=O)NC)[C@@H]3SC2(CC3Br)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H33BrN4O5S/c1-3-12(11-27)26-17(19(29)24-4-5-25-6-8-31-9-7-25)21-10-13(22)16(32-21)14(18(28)23-2)15(21)20(26)30/h12-17,27H,3-11H2,1-2H3,(H,23,28)(H,24,29)/t12?,13?,14-,15+,16-,17?,21?/m1/s1 |
| InChIKey | JWEMIZGFCHKSFJ-QOJUUSBVSA-N |
| XLogP | -0.58 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|