C23H37N3O7 — CID 25084411
ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25084411) has the molecular formula C23H37N3O7 and a molecular weight of 467.56 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25084411 |
| Molecular Formula | C23H37N3O7 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)NCCN2CCOCC2)N(CCCCCO)C(=O)[C@@H]13 |
| InChI | InChI=1S/C23H37N3O7/c1-2-32-22(30)17-16-6-7-23(33-16)18(17)21(29)26(9-4-3-5-13-27)19(23)20(28)24-8-10-25-11-14-31-15-12-25/h16-19,27H,2-15H2,1H3,(H,24,28)/t16-,17+,18+,19-,23+/m0/s1 |
| InChIKey | GHXPQRXDTJOLIG-FWXJUILDSA-N |
| XLogP | -0.46 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|