C22H35N3O7 — CID 25075771
ethyl (1S,2S,5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25075771) has the molecular formula C22H35N3O7 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl (1S,2S,5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1S,2S,5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25075771 |
| Molecular Formula | C22H35N3O7 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | ethyl (1S,2S,5R,6R,7R)-3-[(2S)-1-hydroxybutan-2-yl]-2-(2-morpholin-4-ylethylcarbamoyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N(C(CC)CO)[C@H](C(=O)NCCN3CCOCC3)[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C22H35N3O7/c1-3-14(13-26)25-18(19(27)23-7-8-24-9-11-30-12-10-24)22-6-5-15(32-22)16(17(22)20(25)28)21(29)31-4-2/h14-18,26H,3-13H2,1-2H3,(H,23,27)/t14?,15-,16+,17+,18-,22+/m1/s1 |
| InChIKey | WCNAUNGHNWHBFL-OWMPMSGRSA-N |
| XLogP | -0.86 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |