C25H42N2O6 — CID 25090272
ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25090272) has the molecular formula C25H42N2O6 and a molecular weight of 466.62 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25090272 |
| Molecular Formula | C25H42N2O6 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7S)-3-(5-hydroxypentyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@]3(O2)[C@H](C(=O)NC(C)(C)CC(C)(C)C)N(CCCCCO)C(=O)[C@@H]13 |
| InChI | InChI=1S/C25H42N2O6/c1-7-32-22(31)17-16-11-12-25(33-16)18(17)21(30)27(13-9-8-10-14-28)19(25)20(29)26-24(5,6)15-23(2,3)4/h16-19,28H,7-15H2,1-6H3,(H,26,29)/t16-,17+,18+,19-,25+/m0/s1 |
| InChIKey | VGDYINHOGSCVHA-DEIANPFSSA-N |
| XLogP | 2.42 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|