C21H33BrN2O5S — CID 23894873
ethyl (5S,6R,7R)-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23894873) has the molecular formula C21H33BrN2O5S and a molecular weight of 505.48 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23894873 |
| Molecular Formula | C21H33BrN2O5S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCCCCNC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3SC12CC3Br |
| InChI | InChI=1S/C21H33BrN2O5S/c1-3-5-6-9-23-18(26)17-21-12-13(22)16(30-21)14(20(28)29-4-2)15(21)19(27)24(17)10-7-8-11-25/h13-17,25H,3-12H2,1-2H3,(H,23,26)/t13?,14-,15-,16-,17?,21?/m0/s1 |
| InChIKey | JXOIXTLRMBTGJG-HKXKBOTHSA-N |
| XLogP | 2.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|