C20H31BrN2O5S — CID 23838690
ethyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838690) has the molecular formula C20H31BrN2O5S and a molecular weight of 491.45 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838690 |
| Molecular Formula | C20H31BrN2O5S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-(pentylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCCCCNC(=O)C1N([C@H](C)CO)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@@H]3SC12CC3Br |
| InChI | InChI=1S/C20H31BrN2O5S/c1-4-6-7-8-22-17(25)16-20-9-12(21)15(29-20)13(19(27)28-5-2)14(20)18(26)23(16)11(3)10-24/h11-16,24H,4-10H2,1-3H3,(H,22,25)/t11-,12?,13-,14+,15-,16?,20?/m1/s1 |
| InChIKey | HRGMPERMPCURAI-VZNMPJSFSA-N |
| XLogP | 1.70 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|