C26H39BrN2O5S — CID 23923800
pent-4-enyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23923800) has the molecular formula C26H39BrN2O5S and a molecular weight of 571.58 g/mol. Its IUPAC name is pent-4-enyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23923800 |
| Molecular Formula | C26H39BrN2O5S |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | pent-4-enyl (5S,6S,7S)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)CCCCC)N([C@H](C)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C26H39BrN2O5S/c1-5-8-10-13-28(12-7-3)24(32)22-26-15-18(27)21(35-26)19(25(33)34-14-11-9-6-2)20(26)23(31)29(22)17(4)16-30/h6-7,17-22,30H,2-3,5,8-16H2,1,4H3/t17-,18?,19-,20+,21-,22?,26?/m1/s1 |
| InChIKey | JSSMSICAIUDQPR-HRMCMXRLSA-N |
| XLogP | 3.55 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|