C27H41BrN2O5S — CID 23752766
hex-5-enyl (5S,6R,7R)-8-bromo-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23752766) has the molecular formula C27H41BrN2O5S and a molecular weight of 585.61 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7R)-8-bromo-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7R)-8-bromo-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23752766 |
| Molecular Formula | C27H41BrN2O5S |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | hex-5-enyl (5S,6R,7R)-8-bromo-3-(3-hydroxypropyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCO)C(C(=O)N(CC=C)CCCCC)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C27H41BrN2O5S/c1-4-7-9-11-17-35-26(34)20-21-24(32)30(15-12-16-31)23(27(21)18-19(28)22(20)36-27)25(33)29(13-6-3)14-10-8-5-2/h4,6,19-23,31H,1,3,5,7-18H2,2H3/t19?,20-,21-,22-,23?,27?/m0/s1 |
| InChIKey | ZTTKFRQSZHUWRD-DZKPGLQTSA-N |
| XLogP | 3.94 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|