C30H39BrN2O5S — CID 23867744
hex-5-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23867744) has the molecular formula C30H39BrN2O5S and a molecular weight of 619.62 g/mol. Its IUPAC name is hex-5-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23867744 |
| Molecular Formula | C30H39BrN2O5S |
| Molecular Weight | 619.62 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | hex-5-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C30H39BrN2O5S/c1-3-5-6-12-18-38-29(37)23-24-27(35)33(16-10-11-17-34)26(30(24)19-22(31)25(23)39-30)28(36)32(15-4-2)20-21-13-8-7-9-14-21/h3-4,7-9,13-14,22-26,34H,1-2,5-6,10-12,15-20H2/t22?,23-,24-,25-,26?,30?/m0/s1 |
| InChIKey | VXCPYCBZTDMABU-DVMXDDCXSA-N |
| XLogP | 4.34 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|