C34H39BrN2O5S — CID 23951650
hex-5-enyl (5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23951650) has the molecular formula C34H39BrN2O5S and a molecular weight of 667.67 g/mol. Its IUPAC name is hex-5-enyl (5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23951650 |
| Molecular Formula | C34H39BrN2O5S |
| Molecular Weight | 667.67 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | hex-5-enyl (5S,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)Cc2ccccc2)N([C@H](CO)c2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C34H39BrN2O5S/c1-3-5-6-13-19-42-33(41)27-28-31(39)37(26(22-38)24-16-11-8-12-17-24)30(34(28)20-25(35)29(27)43-34)32(40)36(18-4-2)21-23-14-9-7-10-15-23/h3-4,7-12,14-17,25-30,38H,1-2,5-6,13,18-22H2/t25?,26-,27-,28+,29-,30?,34?/m1/s1 |
| InChIKey | SQOQJKYUKOTNOK-RGDWVCRVSA-N |
| XLogP | 5.30 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|