C28H35BrN2O5S — CID 23923700
but-3-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23923700) has the molecular formula C28H35BrN2O5S and a molecular weight of 591.57 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23923700 |
| Molecular Formula | C28H35BrN2O5S |
| Molecular Weight | 591.57 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | but-3-enyl (5S,6R,7R)-2-[benzyl(prop-2-enyl)carbamoyl]-8-bromo-3-(4-hydroxybutyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C28H35BrN2O5S/c1-3-5-16-36-27(35)21-22-25(33)31(14-9-10-15-32)24(28(22)17-20(29)23(21)37-28)26(34)30(13-4-2)18-19-11-7-6-8-12-19/h3-4,6-8,11-12,20-24,32H,1-2,5,9-10,13-18H2/t20?,21-,22-,23-,24?,28?/m0/s1 |
| InChIKey | XFWILZDTCONCJZ-ZDDBWUGHSA-N |
| XLogP | 3.56 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|