C32H44BrN3O4S — CID 23925739
(5S,6R,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925739) has the molecular formula C32H44BrN3O4S and a molecular weight of 646.69 g/mol. Its IUPAC name is (5S,6R,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925739 |
| Molecular Formula | C32H44BrN3O4S |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 645.22 |
| IUPAC Name | (5S,6R,7R)-6-N-benzyl-8-bromo-3-(4-hydroxybutyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCCC)C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@H]3SC12CC3Br |
| InChI | InChI=1S/C32H44BrN3O4S/c1-4-7-11-18-34(16-5-2)31(40)28-32-21-24(33)27(41-32)25(26(32)30(39)36(28)19-12-13-20-37)29(38)35(17-6-3)22-23-14-9-8-10-15-23/h5-6,8-10,14-15,24-28,37H,2-4,7,11-13,16-22H2,1H3/t24?,25-,26-,27-,28?,32?/m0/s1 |
| InChIKey | QEAAEBQXCQYWPA-VQWOVJBJSA-N |
| XLogP | 4.64 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|