C28H44BrN3O4S — CID 23783974
(5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783974) has the molecular formula C28H44BrN3O4S and a molecular weight of 598.65 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783974 |
| Molecular Formula | C28H44BrN3O4S |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)CCCCC)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C28H44BrN3O4S/c1-5-8-11-16-31(15-7-3)27(36)24-28-19-20(29)23(37-28)21(25(34)30(4)14-6-2)22(28)26(35)32(24)17-12-9-10-13-18-33/h6-7,20-24,33H,2-3,5,8-19H2,1,4H3/t20?,21-,22+,23-,24?,28?/m1/s1 |
| InChIKey | OBUONLRVABNKDA-MKDXIPDRSA-N |
| XLogP | 3.85 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|