C26H40BrN3O5 — CID 23841951
(5R,6R,7S)-8-bromo-2-N-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841951) has the molecular formula C26H40BrN3O5 and a molecular weight of 554.53 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841951 |
| Molecular Formula | C26H40BrN3O5 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)CCCC)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C26H40BrN3O5/c1-5-8-14-29(13-7-3)25(34)22-26-17-18(27)21(35-26)19(23(32)28(4)12-6-2)20(26)24(33)30(22)15-10-9-11-16-31/h6-7,18-22,31H,2-3,5,8-17H2,1,4H3/t18?,19-,20+,21-,22?,26?/m1/s1 |
| InChIKey | HMJXHHDXZRLXAC-XRLZSAPBSA-N |
| XLogP | 2.36 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|