C31H41BrClN3O5 — CID 23813323
(5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813323) has the molecular formula C31H41BrClN3O5 and a molecular weight of 651.04 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813323 |
| Molecular Formula | C31H41BrClN3O5 |
| Molecular Weight | 651.04 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccccc2Cl)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H41BrClN3O5/c1-4-15-34(16-5-2)28(38)24-25-29(39)36(18-11-7-8-12-19-37)27(31(25)20-21(32)26(24)41-31)30(40)35(17-6-3)23-14-10-9-13-22(23)33/h4,6,9-10,13-14,21,24-27,37H,1,3,5,7-8,11-12,15-20H2,2H3/t21?,24-,25+,26-,27?,31?/m1/s1 |
| InChIKey | ZMXUGGXFYCWPKM-MBMPFUGBSA-N |
| XLogP | 4.58 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|