C35H42BrN3O5 — CID 23813575
(5R,6S,7R)-2-N,6-N-dibenzyl-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813575) has the molecular formula C35H42BrN3O5 and a molecular weight of 664.64 g/mol. Its IUPAC name is (5R,6S,7R)-2-N,6-N-dibenzyl-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-2-N,6-N-dibenzyl-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813575 |
| Molecular Formula | C35H42BrN3O5 |
| Molecular Weight | 664.64 g/mol |
| Exact Mass | 663.23 |
| IUPAC Name | (5R,6S,7R)-2-N,6-N-dibenzyl-8-bromo-3-(5-hydroxypentyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C35H42BrN3O5/c1-3-18-37(23-25-14-8-5-9-15-25)32(41)28-29-33(42)39(20-12-7-13-21-40)31(35(29)22-27(36)30(28)44-35)34(43)38(19-4-2)24-26-16-10-6-11-17-26/h3-6,8-11,14-17,27-31,40H,1-2,7,12-13,18-24H2/t27?,28-,29-,30-,31?,35?/m0/s1 |
| InChIKey | HFYAYIYSGVEBCI-WATMLTBGSA-N |
| XLogP | 4.33 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|