C31H42BrN3O5 — CID 23926494
(5R,6S,7R)-6-N-benzyl-8-bromo-2-N-butyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926494) has the molecular formula C31H42BrN3O5 and a molecular weight of 616.60 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-butyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-butyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926494 |
| Molecular Formula | C31H42BrN3O5 |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-butyl-3-(4-hydroxybutyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCC)C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)Cc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C31H42BrN3O5/c1-4-7-17-33(15-5-2)30(39)27-31-20-23(32)26(40-31)24(25(31)29(38)35(27)18-11-12-19-36)28(37)34(16-6-3)21-22-13-9-8-10-14-22/h5-6,8-10,13-14,23-27,36H,2-4,7,11-12,15-21H2,1H3/t23?,24-,25-,26-,27?,31?/m0/s1 |
| InChIKey | BDRFOMXILVQKEL-QZLWTHPZSA-N |
| XLogP | 3.54 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|