C24H37BrN2O6 — CID 23895990
(5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23895990) has the molecular formula C24H37BrN2O6 and a molecular weight of 529.47 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23895990 |
| Molecular Formula | C24H37BrN2O6 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (5R,6R,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(CCCCC)C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C24H37BrN2O6/c1-3-5-8-12-26(11-4-2)22(30)20-24-15-16(25)19(33-24)17(23(31)32)18(24)21(29)27(20)13-9-6-7-10-14-28/h4,16-20,28H,2-3,5-15H2,1H3,(H,31,32)/t16?,17-,18+,19-,20?,24?/m1/s1 |
| InChIKey | DICVKVLWQVXPLS-LMOGFREKSA-N |
| XLogP | 2.58 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|