C24H35BrN2O6 — CID 23753079
but-3-enyl (5R,6R,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23753079) has the molecular formula C24H35BrN2O6 and a molecular weight of 527.46 g/mol. Its IUPAC name is but-3-enyl (5R,6R,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6R,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23753079 |
| Molecular Formula | C24H35BrN2O6 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | but-3-enyl (5R,6R,7S)-8-bromo-2-[butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)CCCC)N(CCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H35BrN2O6/c1-4-7-11-26(10-6-3)22(30)20-24-15-16(25)19(33-24)17(23(31)32-14-8-5-2)18(24)21(29)27(20)12-9-13-28/h5-6,16-20,28H,2-4,7-15H2,1H3/t16?,17-,18+,19-,20?,24?/m1/s1 |
| InChIKey | WEPARHBXRGLHRB-LMOGFREKSA-N |
| XLogP | 2.05 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|