C25H37BrN2O6 — CID 23728364
pent-4-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23728364) has the molecular formula C25H37BrN2O6 and a molecular weight of 541.48 g/mol. Its IUPAC name is pent-4-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23728364 |
| Molecular Formula | C25H37BrN2O6 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | pent-4-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)C(C)(C)C)N(CCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C25H37BrN2O6/c1-6-8-9-14-33-23(32)17-18-21(30)27(12-10-13-29)20(25(18)15-16(26)19(17)34-25)22(31)28(11-7-2)24(3,4)5/h6-7,16-20,29H,1-2,8-15H2,3-5H3/t16?,17-,18+,19-,20?,25?/m1/s1 |
| InChIKey | DYJSLLMCUVASDA-UIUKJUSESA-N |
| XLogP | 2.44 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|