C24H35BrN2O6 — CID 23895992
prop-2-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23895992) has the molecular formula C24H35BrN2O6 and a molecular weight of 527.46 g/mol. Its IUPAC name is prop-2-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23895992 |
| Molecular Formula | C24H35BrN2O6 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | prop-2-enyl (5R,6R,7S)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)C(C)(C)C)N(CCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H35BrN2O6/c1-6-10-27(23(3,4)5)21(30)19-24-14-15(25)18(33-24)16(22(31)32-13-7-2)17(24)20(29)26(19)11-8-9-12-28/h6-7,15-19,28H,1-2,8-14H2,3-5H3/t15?,16-,17+,18-,19?,24?/m1/s1 |
| InChIKey | MZLCYNIBWOXNGJ-YRBUVRFTSA-N |
| XLogP | 2.05 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|