C25H39BrN2O6 — CID 23838648
ethyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23838648) has the molecular formula C25H39BrN2O6 and a molecular weight of 543.50 g/mol. Its IUPAC name is ethyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23838648 |
| Molecular Formula | C25H39BrN2O6 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | ethyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@H]3OC12CC3Br)C(C)(C)C |
| InChI | InChI=1S/C25H39BrN2O6/c1-6-12-28(24(3,4)5)22(31)20-25-15-16(26)19(34-25)17(23(32)33-7-2)18(25)21(30)27(20)13-10-8-9-11-14-29/h6,16-20,29H,1,7-15H2,2-5H3/t16?,17-,18-,19-,20?,25?/m0/s1 |
| InChIKey | ILJLFTWLCOWXPE-AUFFXAIISA-N |
| XLogP | 2.66 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|