C26H39BrN2O6 — CID 23896064
pent-4-enyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23896064) has the molecular formula C26H39BrN2O6 and a molecular weight of 555.51 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23896064 |
| Molecular Formula | C26H39BrN2O6 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | pent-4-enyl (5R,6S,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)N(CC=C)C(C)(C)C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C26H39BrN2O6/c1-6-8-11-15-34-24(33)18-19-22(31)28(13-9-10-14-30)21(26(19)16-17(27)20(18)35-26)23(32)29(12-7-2)25(3,4)5/h6-7,17-21,30H,1-2,8-16H2,3-5H3/t17?,18-,19-,20-,21?,26?/m0/s1 |
| InChIKey | CNFMBGVDHHLDSP-LASUBFFUSA-N |
| XLogP | 2.83 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|