C30H38BrClN2O6 — CID 23895982
hex-5-enyl (5R,6R,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23895982) has the molecular formula C30H38BrClN2O6 and a molecular weight of 638.00 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23895982 |
| Molecular Formula | C30H38BrClN2O6 |
| Molecular Weight | 638.00 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | hex-5-enyl (5R,6R,7S)-8-bromo-2-[(4-chlorophenyl)-prop-2-enylcarbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)N(CC=C)c2ccc(Cl)cc2)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C30H38BrClN2O6/c1-3-5-6-10-18-39-29(38)23-24-27(36)34(16-8-7-9-17-35)26(30(24)19-22(31)25(23)40-30)28(37)33(15-4-2)21-13-11-20(32)12-14-21/h3-4,11-14,22-26,35H,1-2,5-10,15-19H2/t22?,23-,24+,25-,26?,30?/m1/s1 |
| InChIKey | KMRYIWKQTJUFAE-KKDZCOMBSA-N |
| XLogP | 4.67 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|